C15H18ClNO2 — CID 170889123
1-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]butan-2-amine (PubChem CID 170889123) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]butan-2-amine.
| Compound Name | 1-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 170889123 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(-c2ccc(OC)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H18ClNO2/c1-3-11(17)9-12-5-7-14(19-12)10-4-6-15(18-2)13(16)8-10/h4-8,11H,3,9,17H2,1-2H3 |
| InChIKey | RLPPZMOUEHAVPW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |