About [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium
[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium (PubChem CID 8638620) has the molecular formula C20H24NO5+
and a molecular weight of 358.41 g/mol. Its IUPAC name is [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium.
Molecular Properties
| Compound Name | [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium |
| PubChem CID | 8638620 |
| Molecular Formula | C20H24NO5+ |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C[NH2+]C3CCCC3)o2)c1 |
| InChI | InChI=1S/C20H23NO5/c1-24-19(22)14-9-13(10-15(11-14)20(23)25-2)18-8-7-17(26-18)12-21-16-5-3-4-6-16/h7-11,16,21H,3-6,12H2,1-2H3/p+1 |
| InChIKey | KZBGCBCGHNQYBW-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium?
The IUPAC name of [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium (CID 8638620) is [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium.
What is the SMILES notation for [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium?
The canonical SMILES for [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium is COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C[NH2+]C3CCCC3)o2)c1.
What is the InChIKey of [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium?
The InChIKey is KZBGCBCGHNQYBW-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H23NO5/c1-24-19(22)14-9-13(10-15(11-14)20(23)25-2)18-8-7-17(26-18)12-21-16-5-3-4-6-16/h7-11,16,21H,3-6,12H2,1-2H3/p+1.
What are the key properties of [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium?
[5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium has a molecular weight of 358.41 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3,5-bis(methoxycarbonyl)phenyl]furan-2-yl]methyl-cyclopentylazanium is sourced from PubChem (CID 8638620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).