C16H14O6 — CID 960529
dimethyl 5-(5-acetylfuran-2-yl)benzene-1,3-dicarboxylate (PubChem CID 960529) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is dimethyl 5-(5-acetylfuran-2-yl)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(5-acetylfuran-2-yl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 960529 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | dimethyl 5-(5-acetylfuran-2-yl)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(C(C)=O)o2)c1 |
| InChI | InChI=1S/C16H14O6/c1-9(17)13-4-5-14(22-13)10-6-11(15(18)20-2)8-12(7-10)16(19)21-3/h4-8H,1-3H3 |
| InChIKey | MOKDINLPDQOTHH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |