C24H26ClNO6 — CID 17333468
dimethyl 5-[5-[[2-(4-methoxyphenyl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride (PubChem CID 17333468) has the molecular formula C24H26ClNO6 and a molecular weight of 459.93 g/mol. Its IUPAC name is dimethyl 5-[5-[[2-(4-methoxyphenyl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride.
| Compound Name | dimethyl 5-[5-[[2-(4-methoxyphenyl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 17333468 |
| Molecular Formula | C24H26ClNO6 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | dimethyl 5-[5-[[2-(4-methoxyphenyl)ethylamino]methyl]furan-2-yl]benzene-1,3-dicarboxylate;hydrochloride |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-c2ccc(CNCCc3ccc(OC)cc3)o2)c1.Cl |
| InChI | InChI=1S/C24H25NO6.ClH/c1-28-20-6-4-16(5-7-20)10-11-25-15-21-8-9-22(31-21)17-12-18(23(26)29-2)14-19(13-17)24(27)30-3;/h4-9,12-14,25H,10-11,15H2,1-3H3;1H |
| InChIKey | MRKSSAGXWSZNED-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|