C20H22ClNO2 — CID 17331908
2-(4-methoxyphenyl)-N-[(5-phenylfuran-2-yl)methyl]ethanamine;hydrochloride (PubChem CID 17331908) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(5-phenylfuran-2-yl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-N-[(5-phenylfuran-2-yl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17331908 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(5-phenylfuran-2-yl)methyl]ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccc(-c3ccccc3)o2)cc1.Cl |
| InChI | InChI=1S/C20H21NO2.ClH/c1-22-18-9-7-16(8-10-18)13-14-21-15-19-11-12-20(23-19)17-5-3-2-4-6-17;/h2-12,21H,13-15H2,1H3;1H |
| InChIKey | XCOQZORSMQHCSX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|