C15H20Cl2N2O+2 — CID 7425234
2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylazaniumyl]ethyl-dimethylazanium (PubChem CID 7425234) has the molecular formula C15H20Cl2N2O+2 and a molecular weight of 315.24 g/mol. Its IUPAC name is 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylazaniumyl]ethyl-dimethylazanium.
| Compound Name | 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylazaniumyl]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7425234 |
| Molecular Formula | C15H20Cl2N2O+2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[[5-(2,4-dichlorophenyl)furan-2-yl]methylazaniumyl]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC[NH2+]Cc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C15H18Cl2N2O/c1-19(2)8-7-18-10-12-4-6-15(20-12)13-5-3-11(16)9-14(13)17/h3-6,9,18H,7-8,10H2,1-2H3/p+2 |
| InChIKey | XNMBSXOODBHNGL-UHFFFAOYSA-P |
| XLogP | 1.46 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|