C16H19Cl2NO — CID 63398553
1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-propylpropan-2-amine (PubChem CID 63398553) has the molecular formula C16H19Cl2NO and a molecular weight of 312.24 g/mol. Its IUPAC name is 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-propylpropan-2-amine.
| Compound Name | 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 63398553 |
| Molecular Formula | C16H19Cl2NO |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-[5-(2,4-dichlorophenyl)furan-2-yl]-N-propylpropan-2-amine |
| SMILES | CCCNC(C)Cc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C16H19Cl2NO/c1-3-8-19-11(2)9-13-5-7-16(20-13)14-6-4-12(17)10-15(14)18/h4-7,10-11,19H,3,8-9H2,1-2H3 |
| InChIKey | NQTBLSVIBLZNSA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |