C15H16Cl3NO — CID 63398766
N-ethyl-1-[5-(2,4,5-trichlorophenyl)furan-2-yl]propan-2-amine (PubChem CID 63398766) has the molecular formula C15H16Cl3NO and a molecular weight of 332.66 g/mol. Its IUPAC name is N-ethyl-1-[5-(2,4,5-trichlorophenyl)furan-2-yl]propan-2-amine.
| Compound Name | N-ethyl-1-[5-(2,4,5-trichlorophenyl)furan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 63398766 |
| Molecular Formula | C15H16Cl3NO |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | N-ethyl-1-[5-(2,4,5-trichlorophenyl)furan-2-yl]propan-2-amine |
| SMILES | CCNC(C)Cc1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C15H16Cl3NO/c1-3-19-9(2)6-10-4-5-15(20-10)11-7-13(17)14(18)8-12(11)16/h4-5,7-9,19H,3,6H2,1-2H3 |
| InChIKey | JMMJITQATMKSFD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|