C15H15F4NO — CID 107645719
N-ethyl-1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-amine (PubChem CID 107645719) has the molecular formula C15H15F4NO and a molecular weight of 301.28 g/mol. Its IUPAC name is N-ethyl-1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-amine.
| Compound Name | N-ethyl-1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 107645719 |
| Molecular Formula | C15H15F4NO |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-ethyl-1-[5-(2,3,5,6-tetrafluorophenyl)furan-2-yl]propan-2-amine |
| SMILES | CCNC(C)Cc1ccc(-c2c(F)c(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C15H15F4NO/c1-3-20-8(2)6-9-4-5-12(21-9)13-14(18)10(16)7-11(17)15(13)19/h4-5,7-8,20H,3,6H2,1-2H3 |
| InChIKey | IUPJVOVSOHSLGV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|