C16H18F3NO — CID 63085650
N-propyl-1-[5-(2,3,5-trifluorophenyl)furan-2-yl]propan-2-amine (PubChem CID 63085650) has the molecular formula C16H18F3NO and a molecular weight of 297.32 g/mol. Its IUPAC name is N-propyl-1-[5-(2,3,5-trifluorophenyl)furan-2-yl]propan-2-amine.
| Compound Name | N-propyl-1-[5-(2,3,5-trifluorophenyl)furan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 63085650 |
| Molecular Formula | C16H18F3NO |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-propyl-1-[5-(2,3,5-trifluorophenyl)furan-2-yl]propan-2-amine |
| SMILES | CCCNC(C)Cc1ccc(-c2cc(F)cc(F)c2F)o1 |
| InChI | InChI=1S/C16H18F3NO/c1-3-6-20-10(2)7-12-4-5-15(21-12)13-8-11(17)9-14(18)16(13)19/h4-5,8-10,20H,3,6-7H2,1-2H3 |
| InChIKey | DHZMGIFNCUGAFR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|