C16H19BrClNO — CID 107615184
1-[5-(4-bromo-3-chlorophenyl)furan-2-yl]-N-propylpropan-2-amine (PubChem CID 107615184) has the molecular formula C16H19BrClNO and a molecular weight of 356.69 g/mol. Its IUPAC name is 1-[5-(4-bromo-3-chlorophenyl)furan-2-yl]-N-propylpropan-2-amine.
| Compound Name | 1-[5-(4-bromo-3-chlorophenyl)furan-2-yl]-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 107615184 |
| Molecular Formula | C16H19BrClNO |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 1-[5-(4-bromo-3-chlorophenyl)furan-2-yl]-N-propylpropan-2-amine |
| SMILES | CCCNC(C)Cc1ccc(-c2ccc(Br)c(Cl)c2)o1 |
| InChI | InChI=1S/C16H19BrClNO/c1-3-8-19-11(2)9-13-5-7-16(20-13)12-4-6-14(17)15(18)10-12/h4-7,10-11,19H,3,8-9H2,1-2H3 |
| InChIKey | NJXKMWSFKVZJEL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |