C15H16Cl2FNO — CID 107577105
1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-ethylpropan-2-amine (PubChem CID 107577105) has the molecular formula C15H16Cl2FNO and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-ethylpropan-2-amine.
| Compound Name | 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 107577105 |
| Molecular Formula | C15H16Cl2FNO |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-ethylpropan-2-amine |
| SMILES | CCNC(C)Cc1ccc(-c2cc(Cl)c(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H16Cl2FNO/c1-3-19-9(2)6-11-4-5-14(20-11)10-7-12(16)15(18)13(17)8-10/h4-5,7-9,19H,3,6H2,1-2H3 |
| InChIKey | PIPSRHNKYNBRTC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|