C14H12Cl2FNO — CID 107577110
N-[[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]methyl]cyclopropanamine (PubChem CID 107577110) has the molecular formula C14H12Cl2FNO and a molecular weight of 300.16 g/mol. Its IUPAC name is N-[[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107577110 |
| Molecular Formula | C14H12Cl2FNO |
| Molecular Weight | 300.16 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1c(Cl)cc(-c2ccc(CNC3CC3)o2)cc1Cl |
| InChI | InChI=1S/C14H12Cl2FNO/c15-11-5-8(6-12(16)14(11)17)13-4-3-10(19-13)7-18-9-1-2-9/h3-6,9,18H,1-2,7H2 |
| InChIKey | WHHDNTMDKRICIQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.16 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|