C14H13BrFNO — CID 43624961
N-[[5-(5-bromo-2-fluorophenyl)furan-2-yl]methyl]cyclopropanamine (PubChem CID 43624961) has the molecular formula C14H13BrFNO and a molecular weight of 310.17 g/mol. Its IUPAC name is N-[[5-(5-bromo-2-fluorophenyl)furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(5-bromo-2-fluorophenyl)furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43624961 |
| Molecular Formula | C14H13BrFNO |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[[5-(5-bromo-2-fluorophenyl)furan-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Br)cc1-c1ccc(CNC2CC2)o1 |
| InChI | InChI=1S/C14H13BrFNO/c15-9-1-5-13(16)12(7-9)14-6-4-11(18-14)8-17-10-2-3-10/h1,4-7,10,17H,2-3,8H2 |
| InChIKey | ONTZBMPSOVLMQK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |