C14H14INO — CID 43624861
N-[[5-(2-iodophenyl)furan-2-yl]methyl]cyclopropanamine (PubChem CID 43624861) has the molecular formula C14H14INO and a molecular weight of 339.18 g/mol. Its IUPAC name is N-[[5-(2-iodophenyl)furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2-iodophenyl)furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43624861 |
| Molecular Formula | C14H14INO |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-[[5-(2-iodophenyl)furan-2-yl]methyl]cyclopropanamine |
| SMILES | Ic1ccccc1-c1ccc(CNC2CC2)o1 |
| InChI | InChI=1S/C14H14INO/c15-13-4-2-1-3-12(13)14-8-7-11(17-14)9-16-10-5-6-10/h1-4,7-8,10,16H,5-6,9H2 |
| InChIKey | PKIMHAYTAJIHLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|