C15H16BrNO — CID 43624931
N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methyl]cyclopropanamine (PubChem CID 43624931) has the molecular formula C15H16BrNO and a molecular weight of 306.20 g/mol. Its IUPAC name is N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 43624931 |
| Molecular Formula | C15H16BrNO |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | N-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(-c2ccc(CNC3CC3)o2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrNO/c1-10-2-6-13(14(16)8-10)15-7-5-12(18-15)9-17-11-3-4-11/h2,5-8,11,17H,3-4,9H2,1H3 |
| InChIKey | GAMSYMZUYNZJQY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |