C18H23BrClNO — CID 17056388
N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]cyclohexanamine;hydrochloride (PubChem CID 17056388) has the molecular formula C18H23BrClNO and a molecular weight of 384.75 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]cyclohexanamine;hydrochloride.
| Compound Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]cyclohexanamine;hydrochloride |
|---|---|
| PubChem CID | 17056388 |
| Molecular Formula | C18H23BrClNO |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]cyclohexanamine;hydrochloride |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNC2CCCCC2)o1.Cl |
| InChI | InChI=1S/C18H22BrNO.ClH/c1-13-11-14(19)7-9-17(13)18-10-8-16(21-18)12-20-15-5-3-2-4-6-15;/h7-11,15,20H,2-6,12H2,1H3;1H |
| InChIKey | YGQNOWOIYIABRS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |