C18H25BrCl2N2O2 — CID 6471769
N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride (PubChem CID 6471769) has the molecular formula C18H25BrCl2N2O2 and a molecular weight of 452.22 g/mol. Its IUPAC name is N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride.
| Compound Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 6471769 |
| Molecular Formula | C18H25BrCl2N2O2 |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]-2-morpholin-4-ylethanamine;dihydrochloride |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNCCN2CCOCC2)o1.Cl.Cl |
| InChI | InChI=1S/C18H23BrN2O2.2ClH/c1-14-12-15(19)2-4-17(14)18-5-3-16(23-18)13-20-6-7-21-8-10-22-11-9-21;;/h2-5,12,20H,6-11,13H2,1H3;2*1H |
| InChIKey | OIVSZYOVEOAWLL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|