C24H27BrN2O — CID 17159428
1-benzyl-N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]piperidin-4-amine (PubChem CID 17159428) has the molecular formula C24H27BrN2O and a molecular weight of 439.40 g/mol. Its IUPAC name is 1-benzyl-N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]piperidin-4-amine.
| Compound Name | 1-benzyl-N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 17159428 |
| Molecular Formula | C24H27BrN2O |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-benzyl-N-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNC2CCN(Cc3ccccc3)CC2)o1 |
| InChI | InChI=1S/C24H27BrN2O/c1-18-15-20(25)7-9-23(18)24-10-8-22(28-24)16-26-21-11-13-27(14-12-21)17-19-5-3-2-4-6-19/h2-10,15,21,26H,11-14,16-17H2,1H3 |
| InChIKey | CNAVPRLUXWNOSW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |