C23H26Cl3IN2O — CID 17159468
1-benzyl-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]piperidin-4-amine;dihydrochloride (PubChem CID 17159468) has the molecular formula C23H26Cl3IN2O and a molecular weight of 579.74 g/mol. Its IUPAC name is 1-benzyl-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]piperidin-4-amine;dihydrochloride.
| Compound Name | 1-benzyl-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 17159468 |
| Molecular Formula | C23H26Cl3IN2O |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 578.02 |
| IUPAC Name | 1-benzyl-N-[[5-(2-chloro-4-iodophenyl)furan-2-yl]methyl]piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.Clc1cc(I)ccc1-c1ccc(CNC2CCN(Cc3ccccc3)CC2)o1 |
| InChI | InChI=1S/C23H24ClIN2O.2ClH/c24-22-14-18(25)6-8-21(22)23-9-7-20(28-23)15-26-19-10-12-27(13-11-19)16-17-4-2-1-3-5-17;;/h1-9,14,19,26H,10-13,15-16H2;2*1H |
| InChIKey | REPPYNORBSHEQI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|