C16H21BrClNO2 — CID 17056402
2-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methylamino]-2-methylpropan-1-ol;hydrochloride (PubChem CID 17056402) has the molecular formula C16H21BrClNO2 and a molecular weight of 374.71 g/mol. Its IUPAC name is 2-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methylamino]-2-methylpropan-1-ol;hydrochloride.
| Compound Name | 2-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methylamino]-2-methylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17056402 |
| Molecular Formula | C16H21BrClNO2 |
| Molecular Weight | 374.71 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[[5-(4-bromo-2-methylphenyl)furan-2-yl]methylamino]-2-methylpropan-1-ol;hydrochloride |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CNC(C)(C)CO)o1.Cl |
| InChI | InChI=1S/C16H20BrNO2.ClH/c1-11-8-12(17)4-6-14(11)15-7-5-13(20-15)9-18-16(2,3)10-19;/h4-8,18-19H,9-10H2,1-3H3;1H |
| InChIKey | RWEPHIZLGSYNAV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |