C14H15BrN2O2 — CID 91686849
3-[5-(4-bromo-2-methylphenyl)furan-2-yl]propanehydrazide (PubChem CID 91686849) has the molecular formula C14H15BrN2O2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 3-[5-(4-bromo-2-methylphenyl)furan-2-yl]propanehydrazide.
| Compound Name | 3-[5-(4-bromo-2-methylphenyl)furan-2-yl]propanehydrazide |
|---|---|
| PubChem CID | 91686849 |
| Molecular Formula | C14H15BrN2O2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-[5-(4-bromo-2-methylphenyl)furan-2-yl]propanehydrazide |
| SMILES | Cc1cc(Br)ccc1-c1ccc(CCC(=O)NN)o1 |
| InChI | InChI=1S/C14H15BrN2O2/c1-9-8-10(15)2-5-12(9)13-6-3-11(19-13)4-7-14(18)17-16/h2-3,5-6,8H,4,7,16H2,1H3,(H,17,18) |
| InChIKey | DOUGJHPPZBREAL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|