C13H12Cl2N2O2 — CID 91686863
3-[5-(3,4-dichlorophenyl)furan-2-yl]propanehydrazide (PubChem CID 91686863) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 3-[5-(3,4-dichlorophenyl)furan-2-yl]propanehydrazide.
| Compound Name | 3-[5-(3,4-dichlorophenyl)furan-2-yl]propanehydrazide |
|---|---|
| PubChem CID | 91686863 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 3-[5-(3,4-dichlorophenyl)furan-2-yl]propanehydrazide |
| SMILES | NNC(=O)CCc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c14-10-4-1-8(7-11(10)15)12-5-2-9(19-12)3-6-13(18)17-16/h1-2,4-5,7H,3,6,16H2,(H,17,18) |
| InChIKey | SJDAJKCNJROLTM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|