C23H24N2O3 — CID 46271038
N-(4-acetamidophenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide (PubChem CID 46271038) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide.
| Compound Name | N-(4-acetamidophenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide |
|---|---|
| PubChem CID | 46271038 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-(4-acetamidophenyl)-3-[5-(3,4-dimethylphenyl)furan-2-yl]propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CCc2ccc(-c3ccc(C)c(C)c3)o2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-15-4-5-18(14-16(15)2)22-12-10-21(28-22)11-13-23(27)25-20-8-6-19(7-9-20)24-17(3)26/h4-10,12,14H,11,13H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | RHAOLSWDPXKSBW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |