C20H16N2O2S — CID 16651759
[4-[3-(5-phenylfuran-2-yl)propanoylamino]phenyl] thiocyanate (PubChem CID 16651759) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is [4-[3-(5-phenylfuran-2-yl)propanoylamino]phenyl] thiocyanate.
| Compound Name | [4-[3-(5-phenylfuran-2-yl)propanoylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 16651759 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | [4-[3-(5-phenylfuran-2-yl)propanoylamino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)CCc2ccc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C20H16N2O2S/c21-14-25-18-10-6-16(7-11-18)22-20(23)13-9-17-8-12-19(24-17)15-4-2-1-3-5-15/h1-8,10-12H,9,13H2,(H,22,23) |
| InChIKey | KNOLCRQMPOHIIS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|