C20H18ClNO2 — CID 22587391
N-(3-chloro-2-methylphenyl)-3-(5-phenylfuran-2-yl)propanamide (PubChem CID 22587391) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(5-phenylfuran-2-yl)propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(5-phenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 22587391 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(5-phenylfuran-2-yl)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CCc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H18ClNO2/c1-14-17(21)8-5-9-18(14)22-20(23)13-11-16-10-12-19(24-16)15-6-3-2-4-7-15/h2-10,12H,11,13H2,1H3,(H,22,23) |
| InChIKey | WOJRFJXXDGVRFH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |