C25H28N2O6S — CID 24524853
3-[5-(4-methoxyphenyl)furan-2-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 24524853) has the molecular formula C25H28N2O6S and a molecular weight of 484.57 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)furan-2-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 24524853 |
| Molecular Formula | C25H28N2O6S |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | COc1ccc(-c2ccc(CCC(=O)Nc3ccc(C)c(S(=O)(=O)N4CCOCC4)c3)o2)cc1 |
| InChI | InChI=1S/C25H28N2O6S/c1-18-3-6-20(17-24(18)34(29,30)27-13-15-32-16-14-27)26-25(28)12-10-22-9-11-23(33-22)19-4-7-21(31-2)8-5-19/h3-9,11,17H,10,12-16H2,1-2H3,(H,26,28) |
| InChIKey | IKXQTSKHVPFHOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |