C17H21NO3 — CID 22587421
3-[5-(4-methoxyphenyl)furan-2-yl]-N-propylpropanamide (PubChem CID 22587421) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)furan-2-yl]-N-propylpropanamide.
| Compound Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-propylpropanamide |
|---|---|
| PubChem CID | 22587421 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCc1ccc(-c2ccc(OC)cc2)o1 |
| InChI | InChI=1S/C17H21NO3/c1-3-12-18-17(19)11-9-15-8-10-16(21-15)13-4-6-14(20-2)7-5-13/h4-8,10H,3,9,11-12H2,1-2H3,(H,18,19) |
| InChIKey | CHXKTFMTUZTOBM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |