C23H25NO5S — CID 26010955
3-[5-(4-methoxyphenyl)furan-2-yl]-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]propanamide (PubChem CID 26010955) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is 3-[5-(4-methoxyphenyl)furan-2-yl]-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]propanamide.
| Compound Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 26010955 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 3-[5-(4-methoxyphenyl)furan-2-yl]-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]propanamide |
| SMILES | COc1ccc(-c2ccc(CCC(=O)N[C@H](C)c3ccc(S(C)(=O)=O)cc3)o2)cc1 |
| InChI | InChI=1S/C23H25NO5S/c1-16(17-6-12-21(13-7-17)30(3,26)27)24-23(25)15-11-20-10-14-22(29-20)18-4-8-19(28-2)9-5-18/h4-10,12-14,16H,11,15H2,1-3H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | OIGFUKWHQLAFEB-MRXNPFEDSA-N |
| XLogP | 4.17 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |