C21H28N2O6S2 — CID 133165753
4-(4-methoxy-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide (PubChem CID 133165753) has the molecular formula C21H28N2O6S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-(4-methoxy-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide.
| Compound Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133165753 |
| Molecular Formula | C21H28N2O6S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 4-(4-methoxy-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
| SMILES | COc1ccc(N(CCCC(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H28N2O6S2/c1-16(17-7-13-20(14-8-17)30(3,25)26)22-21(24)6-5-15-23(31(4,27)28)18-9-11-19(29-2)12-10-18/h7-14,16H,5-6,15H2,1-4H3,(H,22,24) |
| InChIKey | URMDFPUXKGFTLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |