C21H28N2O5S2 — CID 133165749
4-(2-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide (PubChem CID 133165749) has the molecular formula C21H28N2O5S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 4-(2-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide.
| Compound Name | 4-(2-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133165749 |
| Molecular Formula | C21H28N2O5S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-(2-methyl-N-methylsulfonylanilino)-N-[1-(4-methylsulfonylphenyl)ethyl]butanamide |
| SMILES | Cc1ccccc1N(CCCC(=O)NC(C)c1ccc(S(C)(=O)=O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C21H28N2O5S2/c1-16-8-5-6-9-20(16)23(30(4,27)28)15-7-10-21(24)22-17(2)18-11-13-19(14-12-18)29(3,25)26/h5-6,8-9,11-14,17H,7,10,15H2,1-4H3,(H,22,24) |
| InChIKey | AODXAEJHYIRVQC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |