C20H24ClFN2O3S — CID 53287837
4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[1-(4-fluorophenyl)ethyl]butanamide (PubChem CID 53287837) has the molecular formula C20H24ClFN2O3S and a molecular weight of 426.94 g/mol. Its IUPAC name is 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[1-(4-fluorophenyl)ethyl]butanamide.
| Compound Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[1-(4-fluorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 53287837 |
| Molecular Formula | C20H24ClFN2O3S |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[1-(4-fluorophenyl)ethyl]butanamide |
| SMILES | Cc1c(Cl)cccc1N(CCCC(=O)NC(C)c1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C20H24ClFN2O3S/c1-14-18(21)6-4-7-19(14)24(28(3,26)27)13-5-8-20(25)23-15(2)16-9-11-17(22)12-10-16/h4,6-7,9-12,15H,5,8,13H2,1-3H3,(H,23,25) |
| InChIKey | MMVXPYOHGDSPCC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |