C26H36ClN3O3S — CID 125048957
4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide (PubChem CID 125048957) has the molecular formula C26H36ClN3O3S and a molecular weight of 506.11 g/mol. Its IUPAC name is 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide.
| Compound Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 125048957 |
| Molecular Formula | C26H36ClN3O3S |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-(3-chloro-2-methyl-N-methylsulfonylanilino)-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
| SMILES | Cc1c(Cl)cccc1N(CCCC(=O)N[C@H](C)c1ccc(N2CCC(C)CC2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H36ClN3O3S/c1-19-14-17-29(18-15-19)23-12-10-22(11-13-23)21(3)28-26(31)9-6-16-30(34(4,32)33)25-8-5-7-24(27)20(25)2/h5,7-8,10-13,19,21H,6,9,14-18H2,1-4H3,(H,28,31)/t21-/m1/s1 |
| InChIKey | DJROYMGNELSXKI-OAQYLSRUSA-N |
| XLogP | 5.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|