C24H32ClN3O3S — CID 100736246
2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide (PubChem CID 100736246) has the molecular formula C24H32ClN3O3S and a molecular weight of 478.06 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 100736246 |
| Molecular Formula | C24H32ClN3O3S |
| Molecular Weight | 478.06 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(1R)-1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]acetamide |
| SMILES | CC1CCN(c2ccc([C@@H](C)NC(=O)CN(Cc3ccccc3Cl)S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C24H32ClN3O3S/c1-18-12-14-27(15-13-18)22-10-8-20(9-11-22)19(2)26-24(29)17-28(32(3,30)31)16-21-6-4-5-7-23(21)25/h4-11,18-19H,12-17H2,1-3H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | PHSGLMLPRMTUGR-LJQANCHMSA-N |
| XLogP | 4.22 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.06 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|