C26H37N3O3S — CID 133219457
4-(2-methyl-N-methylsulfonylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]butanamide (PubChem CID 133219457) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is 4-(2-methyl-N-methylsulfonylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]butanamide.
| Compound Name | 4-(2-methyl-N-methylsulfonylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 133219457 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 4-(2-methyl-N-methylsulfonylanilino)-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]butanamide |
| SMILES | Cc1ccccc1N(CCCC(=O)NC(C)c1ccc(N2CCCC(C)C2)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C26H37N3O3S/c1-20-9-7-17-28(19-20)24-15-13-23(14-16-24)22(3)27-26(30)12-8-18-29(33(4,31)32)25-11-6-5-10-21(25)2/h5-6,10-11,13-16,20,22H,7-9,12,17-19H2,1-4H3,(H,27,30) |
| InChIKey | UANYPDOTGJSOMX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|