C21H28N2O3S — CID 21173577
4-(2,5-dimethyl-N-methylsulfonylanilino)-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 21173577) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 4-(2,5-dimethyl-N-methylsulfonylanilino)-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | 4-(2,5-dimethyl-N-methylsulfonylanilino)-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 21173577 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 4-(2,5-dimethyl-N-methylsulfonylanilino)-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | Cc1ccc(C)c(N(CCCC(=O)N[C@H](C)c2ccccc2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H28N2O3S/c1-16-12-13-17(2)20(15-16)23(27(4,25)26)14-8-11-21(24)22-18(3)19-9-6-5-7-10-19/h5-7,9-10,12-13,15,18H,8,11,14H2,1-4H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | NCFKQVNVJNOHRR-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |