C23H31N3O4S — CID 21367609
2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoylamino]-N-propan-2-ylbenzamide (PubChem CID 21367609) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoylamino]-N-propan-2-ylbenzamide.
| Compound Name | 2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoylamino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 21367609 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-[4-(2,5-dimethyl-N-methylsulfonylanilino)butanoylamino]-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C)c(N(CCCC(=O)Nc2ccccc2C(=O)NC(C)C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H31N3O4S/c1-16(2)24-23(28)19-9-6-7-10-20(19)25-22(27)11-8-14-26(31(5,29)30)21-15-17(3)12-13-18(21)4/h6-7,9-10,12-13,15-16H,8,11,14H2,1-5H3,(H,24,28)(H,25,27) |
| InChIKey | FSAUSIPYIHNWDR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |