C22H23NO3 — CID 18120278
N-(3-phenoxypropyl)-3-(5-phenylfuran-2-yl)propanamide (PubChem CID 18120278) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(3-phenoxypropyl)-3-(5-phenylfuran-2-yl)propanamide.
| Compound Name | N-(3-phenoxypropyl)-3-(5-phenylfuran-2-yl)propanamide |
|---|---|
| PubChem CID | 18120278 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(3-phenoxypropyl)-3-(5-phenylfuran-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(-c2ccccc2)o1)NCCCOc1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c24-22(23-16-7-17-25-19-10-5-2-6-11-19)15-13-20-12-14-21(26-20)18-8-3-1-4-9-18/h1-6,8-12,14H,7,13,15-17H2,(H,23,24) |
| InChIKey | LNALWGXPCIFTTH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|