C19H24FNO — CID 4723489
N-[[5-(2-fluorophenyl)furan-2-yl]methyl]cyclooctanamine (PubChem CID 4723489) has the molecular formula C19H24FNO and a molecular weight of 301.40 g/mol. Its IUPAC name is N-[[5-(2-fluorophenyl)furan-2-yl]methyl]cyclooctanamine.
| Compound Name | N-[[5-(2-fluorophenyl)furan-2-yl]methyl]cyclooctanamine |
|---|---|
| PubChem CID | 4723489 |
| Molecular Formula | C19H24FNO |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[[5-(2-fluorophenyl)furan-2-yl]methyl]cyclooctanamine |
| SMILES | Fc1ccccc1-c1ccc(CNC2CCCCCCC2)o1 |
| InChI | InChI=1S/C19H24FNO/c20-18-11-7-6-10-17(18)19-13-12-16(22-19)14-21-15-8-4-2-1-3-5-9-15/h6-7,10-13,15,21H,1-5,8-9,14H2 |
| InChIKey | VPYPEWNWJROGDG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |