C14H10F5NO — CID 115564773
N-[[5-(2,3,4,5,6-pentafluorophenyl)furan-2-yl]methyl]cyclopropanamine (PubChem CID 115564773) has the molecular formula C14H10F5NO and a molecular weight of 303.23 g/mol. Its IUPAC name is N-[[5-(2,3,4,5,6-pentafluorophenyl)furan-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-(2,3,4,5,6-pentafluorophenyl)furan-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115564773 |
| Molecular Formula | C14H10F5NO |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-[[5-(2,3,4,5,6-pentafluorophenyl)furan-2-yl]methyl]cyclopropanamine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(CNC3CC3)o2)c(F)c1F |
| InChI | InChI=1S/C14H10F5NO/c15-10-9(11(16)13(18)14(19)12(10)17)8-4-3-7(21-8)5-20-6-1-2-6/h3-4,6,20H,1-2,5H2 |
| InChIKey | CLCNWKRRNIGMLV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|