C14H14Cl2FNO — CID 107577112
1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine (PubChem CID 107577112) has the molecular formula C14H14Cl2FNO and a molecular weight of 302.18 g/mol. Its IUPAC name is 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine.
| Compound Name | 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 107577112 |
| Molecular Formula | C14H14Cl2FNO |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1-[5-(3,5-dichloro-4-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccc(-c2cc(Cl)c(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C14H14Cl2FNO/c1-3-11(18-2)13-5-4-12(19-13)8-6-9(15)14(17)10(16)7-8/h4-7,11,18H,3H2,1-2H3 |
| InChIKey | OADBFAPNYJHVDZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|