C14H15ClFNO — CID 62633284
1-[5-(4-chloro-3-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine (PubChem CID 62633284) has the molecular formula C14H15ClFNO and a molecular weight of 267.73 g/mol. Its IUPAC name is 1-[5-(4-chloro-3-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine.
| Compound Name | 1-[5-(4-chloro-3-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 62633284 |
| Molecular Formula | C14H15ClFNO |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-[5-(4-chloro-3-fluorophenyl)furan-2-yl]-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccc(-c2ccc(Cl)c(F)c2)o1 |
| InChI | InChI=1S/C14H15ClFNO/c1-3-12(17-2)14-7-6-13(18-14)9-4-5-10(15)11(16)8-9/h4-8,12,17H,3H2,1-2H3 |
| InChIKey | KELBBEKVKJPKSM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |