C15H16BrF2NO — CID 107615154
1-[5-(4-bromo-2,5-difluorophenyl)furan-2-yl]-N-ethylpropan-2-amine (PubChem CID 107615154) has the molecular formula C15H16BrF2NO and a molecular weight of 344.20 g/mol. Its IUPAC name is 1-[5-(4-bromo-2,5-difluorophenyl)furan-2-yl]-N-ethylpropan-2-amine.
| Compound Name | 1-[5-(4-bromo-2,5-difluorophenyl)furan-2-yl]-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 107615154 |
| Molecular Formula | C15H16BrF2NO |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 1-[5-(4-bromo-2,5-difluorophenyl)furan-2-yl]-N-ethylpropan-2-amine |
| SMILES | CCNC(C)Cc1ccc(-c2cc(F)c(Br)cc2F)o1 |
| InChI | InChI=1S/C15H16BrF2NO/c1-3-19-9(2)6-10-4-5-15(20-10)11-7-14(18)12(16)8-13(11)17/h4-5,7-9,19H,3,6H2,1-2H3 |
| InChIKey | PUFCAWQHYKCKPH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|