C19H17Cl2FNO+ — CID 8636811
[5-(2,4-dichlorophenyl)furan-2-yl]methyl-[2-(2-fluorophenyl)ethyl]azanium (PubChem CID 8636811) has the molecular formula C19H17Cl2FNO+ and a molecular weight of 365.26 g/mol. Its IUPAC name is [5-(2,4-dichlorophenyl)furan-2-yl]methyl-[2-(2-fluorophenyl)ethyl]azanium.
| Compound Name | [5-(2,4-dichlorophenyl)furan-2-yl]methyl-[2-(2-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8636811 |
| Molecular Formula | C19H17Cl2FNO+ |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [5-(2,4-dichlorophenyl)furan-2-yl]methyl-[2-(2-fluorophenyl)ethyl]azanium |
| SMILES | Fc1ccccc1CC[NH2+]Cc1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C19H16Cl2FNO/c20-14-5-7-16(17(21)11-14)19-8-6-15(24-19)12-23-10-9-13-3-1-2-4-18(13)22/h1-8,11,23H,9-10,12H2/p+1 |
| InChIKey | SHAXNHHQOBLLPJ-UHFFFAOYSA-O |
| XLogP | 4.70 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|