C18H23ClN2O — CID 17215860
N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine (PubChem CID 17215860) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine.
| Compound Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 17215860 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[[5-(3-chlorophenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine |
| SMILES | CCN1CCCC1CNCc1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C18H23ClN2O/c1-2-21-10-4-7-16(21)12-20-13-17-8-9-18(22-17)14-5-3-6-15(19)11-14/h3,5-6,8-9,11,16,20H,2,4,7,10,12-13H2,1H3 |
| InChIKey | FTQDGCRJBVJKHE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |