C19H25ClN2O2 — CID 17215876
N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine (PubChem CID 17215876) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine.
| Compound Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine |
|---|---|
| PubChem CID | 17215876 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methyl]-1-(1-ethylpyrrolidin-2-yl)methanamine |
| SMILES | CCN1CCCC1CNCc1ccc(-c2ccc(OC)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-3-22-10-4-5-15(22)12-21-13-16-7-9-18(24-16)14-6-8-19(23-2)17(20)11-14/h6-9,11,15,21H,3-5,10,12-13H2,1-2H3 |
| InChIKey | HOIFSAIDAIHGAR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |