C23H29ClNO+ — CID 8622776
[(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chlorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8622776) has the molecular formula C23H29ClNO+ and a molecular weight of 370.94 g/mol. Its IUPAC name is [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chlorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chlorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8622776 |
| Molecular Formula | C23H29ClNO+ |
| Molecular Weight | 370.94 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [(1R)-1-(1-adamantyl)ethyl]-[[5-(3-chlorophenyl)furan-2-yl]methyl]azanium |
| SMILES | C[C@@H]([NH2+]Cc1ccc(-c2cccc(Cl)c2)o1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H28ClNO/c1-15(23-11-16-7-17(12-23)9-18(8-16)13-23)25-14-21-5-6-22(26-21)19-3-2-4-20(24)10-19/h2-6,10,15-18,25H,7-9,11-14H2,1H3/p+1/t15-,16?,17?,18?,23?/m1/s1 |
| InChIKey | INAAQPQRHSELAX-LRYXAPPNSA-O |
| XLogP | 5.27 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |