C15H20NO+ — CID 8621940
[(2R)-butan-2-yl]-[(5-phenylfuran-2-yl)methyl]azanium (PubChem CID 8621940) has the molecular formula C15H20NO+ and a molecular weight of 230.33 g/mol. Its IUPAC name is [(2R)-butan-2-yl]-[(5-phenylfuran-2-yl)methyl]azanium.
| Compound Name | [(2R)-butan-2-yl]-[(5-phenylfuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8621940 |
| Molecular Formula | C15H20NO+ |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [(2R)-butan-2-yl]-[(5-phenylfuran-2-yl)methyl]azanium |
| SMILES | CC[C@@H](C)[NH2+]Cc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H19NO/c1-3-12(2)16-11-14-9-10-15(17-14)13-7-5-4-6-8-13/h4-10,12,16H,3,11H2,1-2H3/p+1/t12-/m1/s1 |
| InChIKey | FKAFBRPECGWOHV-GFCCVEGCSA-O |
| XLogP | 2.81 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |