C15H19FNO+ — CID 8622197
[(2S)-butan-2-yl]-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium (PubChem CID 8622197) has the molecular formula C15H19FNO+ and a molecular weight of 248.32 g/mol. Its IUPAC name is [(2S)-butan-2-yl]-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium.
| Compound Name | [(2S)-butan-2-yl]-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 8622197 |
| Molecular Formula | C15H19FNO+ |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(2S)-butan-2-yl]-[[5-(4-fluorophenyl)furan-2-yl]methyl]azanium |
| SMILES | CC[C@H](C)[NH2+]Cc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C15H18FNO/c1-3-11(2)17-10-14-8-9-15(18-14)12-4-6-13(16)7-5-12/h4-9,11,17H,3,10H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | DIRYSVUCKWWNQP-NSHDSACASA-O |
| XLogP | 2.95 |
| TPSA | 29.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |