C26H28ClFN4 — CID 124782814
N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]adamantan-1-amine (PubChem CID 124782814) has the molecular formula C26H28ClFN4 and a molecular weight of 450.99 g/mol. Its IUPAC name is N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]adamantan-1-amine.
| Compound Name | N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]adamantan-1-amine |
|---|---|
| PubChem CID | 124782814 |
| Molecular Formula | C26H28ClFN4 |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[[2-[(2-chloro-6-fluorophenyl)methyl]-5-phenyltriazol-4-yl]methyl]adamantan-1-amine |
| SMILES | Fc1cccc(Cl)c1Cn1nc(CNC23CC4CC(CC(C4)C2)C3)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H28ClFN4/c27-22-7-4-8-23(28)21(22)16-32-30-24(25(31-32)20-5-2-1-3-6-20)15-29-26-12-17-9-18(13-26)11-19(10-17)14-26/h1-8,17-19,29H,9-16H2 |
| InChIKey | JVEKYQPTTSTBDL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |